C33H50N10O6 — CID 178160691
1-N,3-N-bis(2-aminoethyl)-5-[[3-[3,5-bis(2-aminoethylcarbamoyl)-2,4,6-trimethylanilino]-3-oxopropanoyl]amino]-2,4,6-trimethylbenzene-1,3-dicarboxamide (PubChem CID 178160691) has the molecular formula C33H50N10O6 and a molecular weight of 682.83 g/mol. Its IUPAC name is 1-N,3-N-bis(2-aminoethyl)-5-[[3-[3,5-bis(2-aminoethylcarbamoyl)-2,4,6-trimethylanilino]-3-oxopropanoyl]amino]-2,4,6-trimethylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-aminoethyl)-5-[[3-[3,5-bis(2-aminoethylcarbamoyl)-2,4,6-trimethylanilino]-3-oxopropanoyl]amino]-2,4,6-trimethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 178160691 |
| Molecular Formula | C33H50N10O6 |
| Molecular Weight | 682.83 g/mol |
| Exact Mass | 682.39 |
| IUPAC Name | 1-N,3-N-bis(2-aminoethyl)-5-[[3-[3,5-bis(2-aminoethylcarbamoyl)-2,4,6-trimethylanilino]-3-oxopropanoyl]amino]-2,4,6-trimethylbenzene-1,3-dicarboxamide |
| SMILES | Cc1c(NC(=O)CC(=O)Nc2c(C)c(C(=O)NCCN)c(C)c(C(=O)NCCN)c2C)c(C)c(C(=O)NCCN)c(C)c1C(=O)NCCN |
| InChI | InChI=1S/C33H50N10O6/c1-16-24(30(46)38-11-7-34)18(3)28(19(4)25(16)31(47)39-12-8-35)42-22(44)15-23(45)43-29-20(5)26(32(48)40-13-9-36)17(2)27(21(29)6)33(49)41-14-10-37/h7-15,34-37H2,1-6H3,(H,38,46)(H,39,47)(H,40,48)(H,41,49)(H,42,44)(H,43,45) |
| InChIKey | VEUJSFPBIWBIRR-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 278.68 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.83 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|