C9H10I3N3O — CID 22102040
3-amino-N-(2-aminoethyl)-2,4,6-triiodobenzamide (PubChem CID 22102040) has the molecular formula C9H10I3N3O and a molecular weight of 556.91 g/mol. Its IUPAC name is 3-amino-N-(2-aminoethyl)-2,4,6-triiodobenzamide.
| Compound Name | 3-amino-N-(2-aminoethyl)-2,4,6-triiodobenzamide |
|---|---|
| PubChem CID | 22102040 |
| Molecular Formula | C9H10I3N3O |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.80 |
| IUPAC Name | 3-amino-N-(2-aminoethyl)-2,4,6-triiodobenzamide |
| SMILES | NCCNC(=O)c1c(I)cc(I)c(N)c1I |
| InChI | InChI=1S/C9H10I3N3O/c10-4-3-5(11)8(14)7(12)6(4)9(16)15-2-1-13/h3H,1-2,13-14H2,(H,15,16) |
| InChIKey | DIOXFZSBNORKJS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|