C13H14I3NO5 — CID 24836090
4-[3-(2-hydroxyethylcarbamoyl)-2,4,6-triiodophenoxy]butanoic acid (PubChem CID 24836090) has the molecular formula C13H14I3NO5 and a molecular weight of 644.97 g/mol. Its IUPAC name is 4-[3-(2-hydroxyethylcarbamoyl)-2,4,6-triiodophenoxy]butanoic acid.
| Compound Name | 4-[3-(2-hydroxyethylcarbamoyl)-2,4,6-triiodophenoxy]butanoic acid |
|---|---|
| PubChem CID | 24836090 |
| Molecular Formula | C13H14I3NO5 |
| Molecular Weight | 644.97 g/mol |
| Exact Mass | 644.80 |
| IUPAC Name | 4-[3-(2-hydroxyethylcarbamoyl)-2,4,6-triiodophenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1c(I)cc(I)c(C(=O)NCCO)c1I |
| InChI | InChI=1S/C13H14I3NO5/c14-7-6-8(15)12(22-5-1-2-9(19)20)11(16)10(7)13(21)17-3-4-18/h6,18H,1-5H2,(H,17,21)(H,19,20) |
| InChIKey | PBDFJUGGJMCKBN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.97 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|