sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate

C11H11I3NNaO2 — CID 137321597

IUPACsodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate
SMILESCCCCNC(=O)c1c(I)cc(I)c([O-])c1I.[Na+]
InChIInChI=1S/C11H12I3NO2.Na/c1-2-3-4-15-11(17)8-6(12)5-7(13)10(16)9(8)14;/h5,16H,2-4H2,1H3,(H,15,17);/q;+1/p-1
InChIKeyJRHFDDBCDFDXFY-UHFFFAOYSA-M
MW592.92 g/mol
LogP0.11
Rot. Bonds4

About sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate

sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate (PubChem CID 137321597) has the molecular formula C11H11I3NNaO2 and a molecular weight of 592.92 g/mol. Its IUPAC name is sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate.

Molecular Properties

Compound Namesodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate
PubChem CID137321597
Molecular FormulaC11H11I3NNaO2
Molecular Weight592.92 g/mol
Exact Mass592.78
IUPAC Namesodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate
SMILESCCCCNC(=O)c1c(I)cc(I)c([O-])c1I.[Na+]
InChIInChI=1S/C11H12I3NO2.Na/c1-2-3-4-15-11(17)8-6(12)5-7(13)10(16)9(8)14;/h5,16H,2-4H2,1H3,(H,15,17);/q;+1/p-1
InChIKeyJRHFDDBCDFDXFY-UHFFFAOYSA-M
XLogP0.11
TPSA52.16 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500592.92
LogP ≤ 50.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate?
The IUPAC name of sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate (CID 137321597) is sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate.
What is the SMILES notation for sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate?
The canonical SMILES for sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate is CCCCNC(=O)c1c(I)cc(I)c([O-])c1I.[Na+].
What is the InChIKey of sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate?
The InChIKey is JRHFDDBCDFDXFY-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12I3NO2.Na/c1-2-3-4-15-11(17)8-6(12)5-7(13)10(16)9(8)14;/h5,16H,2-4H2,1H3,(H,15,17);/q;+1/p-1.
What are the key properties of sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate?
sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate has a molecular weight of 592.92 g/mol, XLogP of 0.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate is sourced from PubChem (CID 137321597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).