C11H11I3NNaO2 — CID 137321597
sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate (PubChem CID 137321597) has the molecular formula C11H11I3NNaO2 and a molecular weight of 592.92 g/mol. Its IUPAC name is sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate.
| Compound Name | sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate |
|---|---|
| PubChem CID | 137321597 |
| Molecular Formula | C11H11I3NNaO2 |
| Molecular Weight | 592.92 g/mol |
| Exact Mass | 592.78 |
| IUPAC Name | sodium 3-(butylcarbamoyl)-2,4,6-triiodophenolate |
| SMILES | CCCCNC(=O)c1c(I)cc(I)c([O-])c1I.[Na+] |
| InChI | InChI=1S/C11H12I3NO2.Na/c1-2-3-4-15-11(17)8-6(12)5-7(13)10(16)9(8)14;/h5,16H,2-4H2,1H3,(H,15,17);/q;+1/p-1 |
| InChIKey | JRHFDDBCDFDXFY-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.92 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|