C12H14I3NO2 — CID 13149464
2-hydroxy-3,4,5-triiodo-N-pentylbenzamide (PubChem CID 13149464) has the molecular formula C12H14I3NO2 and a molecular weight of 584.96 g/mol. Its IUPAC name is 2-hydroxy-3,4,5-triiodo-N-pentylbenzamide.
| Compound Name | 2-hydroxy-3,4,5-triiodo-N-pentylbenzamide |
|---|---|
| PubChem CID | 13149464 |
| Molecular Formula | C12H14I3NO2 |
| Molecular Weight | 584.96 g/mol |
| Exact Mass | 584.82 |
| IUPAC Name | 2-hydroxy-3,4,5-triiodo-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cc(I)c(I)c(I)c1O |
| InChI | InChI=1S/C12H14I3NO2/c1-2-3-4-5-16-12(18)7-6-8(13)9(14)10(15)11(7)17/h6,17H,2-5H2,1H3,(H,16,18) |
| InChIKey | CECUIKSFMSSGDK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|