C26H30I6N2O8 — CID 87617335
3-[2-[2-[2-[3-(3-amino-2,4,6-triiodobenzoyl)oxypropoxy]ethoxy]ethoxy]ethoxy]propyl 3-amino-2,4,6-triiodobenzoate (PubChem CID 87617335) has the molecular formula C26H30I6N2O8 and a molecular weight of 1259.96 g/mol. Its IUPAC name is 3-[2-[2-[2-[3-(3-amino-2,4,6-triiodobenzoyl)oxypropoxy]ethoxy]ethoxy]ethoxy]propyl 3-amino-2,4,6-triiodobenzoate.
| Compound Name | 3-[2-[2-[2-[3-(3-amino-2,4,6-triiodobenzoyl)oxypropoxy]ethoxy]ethoxy]ethoxy]propyl 3-amino-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 87617335 |
| Molecular Formula | C26H30I6N2O8 |
| Molecular Weight | 1259.96 g/mol |
| Exact Mass | 1259.63 |
| IUPAC Name | 3-[2-[2-[2-[3-(3-amino-2,4,6-triiodobenzoyl)oxypropoxy]ethoxy]ethoxy]ethoxy]propyl 3-amino-2,4,6-triiodobenzoate |
| SMILES | Nc1c(I)cc(I)c(C(=O)OCCCOCCOCCOCCOCCCOC(=O)c2c(I)cc(I)c(N)c2I)c1I |
| InChI | InChI=1S/C26H30I6N2O8/c27-15-13-17(29)23(33)21(31)19(15)25(35)41-5-1-3-37-7-9-39-11-12-40-10-8-38-4-2-6-42-26(36)20-16(28)14-18(30)24(34)22(20)32/h13-14H,1-12,33-34H2 |
| InChIKey | BATVKMHZSRIQPM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1259.96 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|