C19H15I3N2O7 — CID 3405668
dimethyl 2-[[2-(3-amino-2,4,6-triiodobenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 3405668) has the molecular formula C19H15I3N2O7 and a molecular weight of 764.05 g/mol. Its IUPAC name is dimethyl 2-[[2-(3-amino-2,4,6-triiodobenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(3-amino-2,4,6-triiodobenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 3405668 |
| Molecular Formula | C19H15I3N2O7 |
| Molecular Weight | 764.05 g/mol |
| Exact Mass | 763.80 |
| IUPAC Name | dimethyl 2-[[2-(3-amino-2,4,6-triiodobenzoyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)c2c(I)cc(I)c(N)c2I)c1 |
| InChI | InChI=1S/C19H15I3N2O7/c1-29-17(26)8-3-4-9(18(27)30-2)12(5-8)24-13(25)7-31-19(28)14-10(20)6-11(21)16(23)15(14)22/h3-6H,7,23H2,1-2H3,(H,24,25) |
| InChIKey | CYLDKBNILPTVJJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.05 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|