C11H10I3NO4 — CID 23199705
(2-ethoxy-2-oxoethyl) 3-amino-2,4,6-triiodobenzoate (PubChem CID 23199705) has the molecular formula C11H10I3NO4 and a molecular weight of 600.92 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 3-amino-2,4,6-triiodobenzoate.
| Compound Name | (2-ethoxy-2-oxoethyl) 3-amino-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 23199705 |
| Molecular Formula | C11H10I3NO4 |
| Molecular Weight | 600.92 g/mol |
| Exact Mass | 600.77 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 3-amino-2,4,6-triiodobenzoate |
| SMILES | CCOC(=O)COC(=O)c1c(I)cc(I)c(N)c1I |
| InChI | InChI=1S/C11H10I3NO4/c1-2-18-7(16)4-19-11(17)8-5(12)3-6(13)10(15)9(8)14/h3H,2,4,15H2,1H3 |
| InChIKey | CIIQLGSBZCXIDH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|