C27H26N2O7 — CID 23996487
dimethyl 2-[[2-(2-methyl-1,2,3,4-tetrahydroacridine-9-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 23996487) has the molecular formula C27H26N2O7 and a molecular weight of 490.51 g/mol. Its IUPAC name is dimethyl 2-[[2-(2-methyl-1,2,3,4-tetrahydroacridine-9-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(2-methyl-1,2,3,4-tetrahydroacridine-9-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23996487 |
| Molecular Formula | C27H26N2O7 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | dimethyl 2-[[2-(2-methyl-1,2,3,4-tetrahydroacridine-9-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)c2c3c(nc4ccccc24)CCC(C)C3)c1 |
| InChI | InChI=1S/C27H26N2O7/c1-15-8-11-21-19(12-15)24(17-6-4-5-7-20(17)28-21)27(33)36-14-23(30)29-22-13-16(25(31)34-2)9-10-18(22)26(32)35-3/h4-7,9-10,13,15H,8,11-12,14H2,1-3H3,(H,29,30) |
| InChIKey | UWGMXAXAPGYCKS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|