C14H16I3NO4 — CID 20548180
butoxymethyl 3-acetamido-2,4,6-triiodobenzoate (PubChem CID 20548180) has the molecular formula C14H16I3NO4 and a molecular weight of 643.00 g/mol. Its IUPAC name is butoxymethyl 3-acetamido-2,4,6-triiodobenzoate.
| Compound Name | butoxymethyl 3-acetamido-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 20548180 |
| Molecular Formula | C14H16I3NO4 |
| Molecular Weight | 643.00 g/mol |
| Exact Mass | 642.82 |
| IUPAC Name | butoxymethyl 3-acetamido-2,4,6-triiodobenzoate |
| SMILES | CCCCOCOC(=O)c1c(I)cc(I)c(NC(C)=O)c1I |
| InChI | InChI=1S/C14H16I3NO4/c1-3-4-5-21-7-22-14(20)11-9(15)6-10(16)13(12(11)17)18-8(2)19/h6H,3-5,7H2,1-2H3,(H,18,19) |
| InChIKey | JRKAQEQYAGTSGY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.00 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|