C11H11I3N2O4 — CID 22754093
3-amino-5-(3-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid (PubChem CID 22754093) has the molecular formula C11H11I3N2O4 and a molecular weight of 615.93 g/mol. Its IUPAC name is 3-amino-5-(3-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid.
| Compound Name | 3-amino-5-(3-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 22754093 |
| Molecular Formula | C11H11I3N2O4 |
| Molecular Weight | 615.93 g/mol |
| Exact Mass | 615.79 |
| IUPAC Name | 3-amino-5-(3-hydroxypropylcarbamoyl)-2,4,6-triiodobenzoic acid |
| SMILES | Nc1c(I)c(C(=O)O)c(I)c(C(=O)NCCCO)c1I |
| InChI | InChI=1S/C11H11I3N2O4/c12-6-4(10(18)16-2-1-3-17)7(13)9(15)8(14)5(6)11(19)20/h17H,1-3,15H2,(H,16,18)(H,19,20) |
| InChIKey | ISCCRDAEMBVAOV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.93 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|