C14H15I3N4O2 — CID 141409902
3-amino-5-[[bis(prop-2-enyl)amino]carbamoyl]-2,4,6-triiodobenzamide (PubChem CID 141409902) has the molecular formula C14H15I3N4O2 and a molecular weight of 652.01 g/mol. Its IUPAC name is 3-amino-5-[[bis(prop-2-enyl)amino]carbamoyl]-2,4,6-triiodobenzamide.
| Compound Name | 3-amino-5-[[bis(prop-2-enyl)amino]carbamoyl]-2,4,6-triiodobenzamide |
|---|---|
| PubChem CID | 141409902 |
| Molecular Formula | C14H15I3N4O2 |
| Molecular Weight | 652.01 g/mol |
| Exact Mass | 651.83 |
| IUPAC Name | 3-amino-5-[[bis(prop-2-enyl)amino]carbamoyl]-2,4,6-triiodobenzamide |
| SMILES | C=CCN(CC=C)NC(=O)c1c(I)c(N)c(I)c(C(N)=O)c1I |
| InChI | InChI=1S/C14H15I3N4O2/c1-3-5-21(6-4-2)20-14(23)8-9(15)7(13(19)22)10(16)12(18)11(8)17/h3-4H,1-2,5-6,18H2,(H2,19,22)(H,20,23) |
| InChIKey | MCLFZBPZEAIWDR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.01 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|