C21H25I2N3O2 — CID 143579091
5-amino-4,6-diiodo-2-methyl-1-N,1-N,3-N,3-N-tetrakis(prop-2-enyl)benzene-1,3-dicarboxamide (PubChem CID 143579091) has the molecular formula C21H25I2N3O2 and a molecular weight of 605.26 g/mol. Its IUPAC name is 5-amino-4,6-diiodo-2-methyl-1-N,1-N,3-N,3-N-tetrakis(prop-2-enyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-amino-4,6-diiodo-2-methyl-1-N,1-N,3-N,3-N-tetrakis(prop-2-enyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 143579091 |
| Molecular Formula | C21H25I2N3O2 |
| Molecular Weight | 605.26 g/mol |
| Exact Mass | 605.00 |
| IUPAC Name | 5-amino-4,6-diiodo-2-methyl-1-N,1-N,3-N,3-N-tetrakis(prop-2-enyl)benzene-1,3-dicarboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1c(C)c(C(=O)N(CC=C)CC=C)c(I)c(N)c1I |
| InChI | InChI=1S/C21H25I2N3O2/c1-6-10-25(11-7-2)20(27)15-14(5)16(18(23)19(24)17(15)22)21(28)26(12-8-3)13-9-4/h6-9H,1-4,10-13,24H2,5H3 |
| InChIKey | SKVSRVMJYOKPAL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|