C8H13N3O2 — CID 83617653
N-(2-aminoethyl)-2-(4-methyl-1,3-oxazol-2-yl)acetamide (PubChem CID 83617653) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4-methyl-1,3-oxazol-2-yl)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(4-methyl-1,3-oxazol-2-yl)acetamide |
|---|---|
| PubChem CID | 83617653 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-(2-aminoethyl)-2-(4-methyl-1,3-oxazol-2-yl)acetamide |
| SMILES | Cc1coc(CC(=O)NCCN)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-6-5-13-8(11-6)4-7(12)10-3-2-9/h5H,2-4,9H2,1H3,(H,10,12) |
| InChIKey | DPSDYGDOXXXPFY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |