C9H15N3O2 — CID 83617752
N-(3-aminopropyl)-2-(3-methyl-1,2-oxazol-4-yl)acetamide (PubChem CID 83617752) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(3-methyl-1,2-oxazol-4-yl)acetamide.
| Compound Name | N-(3-aminopropyl)-2-(3-methyl-1,2-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 83617752 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(3-aminopropyl)-2-(3-methyl-1,2-oxazol-4-yl)acetamide |
| SMILES | Cc1nocc1CC(=O)NCCCN |
| InChI | InChI=1S/C9H15N3O2/c1-7-8(6-14-12-7)5-9(13)11-4-2-3-10/h6H,2-5,10H2,1H3,(H,11,13) |
| InChIKey | DENHWEPLHGCGBM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|