C9H16N4O — CID 83617756
N-(3-aminopropyl)-2-(5-methyl-1H-pyrazol-4-yl)acetamide (PubChem CID 83617756) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(5-methyl-1H-pyrazol-4-yl)acetamide.
| Compound Name | N-(3-aminopropyl)-2-(5-methyl-1H-pyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 83617756 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-(3-aminopropyl)-2-(5-methyl-1H-pyrazol-4-yl)acetamide |
| SMILES | Cc1[nH]ncc1CC(=O)NCCCN |
| InChI | InChI=1S/C9H16N4O/c1-7-8(6-12-13-7)5-9(14)11-4-2-3-10/h6H,2-5,10H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | AUYMQLYDCRGDEM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|