C30H54O3Si — CID 172743236
(4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-16-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 172743236) has the molecular formula C30H54O3Si and a molecular weight of 490.85 g/mol. Its IUPAC name is (4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-16-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-16-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 172743236 |
| Molecular Formula | C30H54O3Si |
| Molecular Weight | 490.85 g/mol |
| Exact Mass | 490.38 |
| IUPAC Name | (4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-16-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1C(O[Si](C)(C)C(C)(C)C)C[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H54O3Si/c1-20(12-15-26(31)32)27-25(33-34(7,8)28(2,3)4)19-24-22-14-13-21-11-9-10-17-29(21,5)23(22)16-18-30(24,27)6/h20-25,27H,9-19H2,1-8H3,(H,31,32)/t20-,21+,22-,23+,24+,25?,27+,29+,30+/m1/s1 |
| InChIKey | JJKZOYRXJPBPCL-VBFWTGSASA-N |
| XLogP | 8.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.85 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|