C28H48O4 — CID 150086627
(4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-6-ethyl-16-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 150086627) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is (4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-6-ethyl-16-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-6-ethyl-16-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 150086627 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | (4R)-4-[(5S,8R,9S,10S,13S,14S,17R)-6-ethyl-16-(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CCC1C[C@@H]2[C@H](CC[C@]3(C)[C@@H]([C@H](C)CCC(=O)O)C(OCOC)C[C@@H]23)[C@@]2(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C28H48O4/c1-6-19-15-20-22(27(3)13-8-7-9-21(19)27)12-14-28(4)23(20)16-24(32-17-31-5)26(28)18(2)10-11-25(29)30/h18-24,26H,6-17H2,1-5H3,(H,29,30)/t18-,19?,20-,21+,22+,23+,24?,26+,27+,28+/m1/s1 |
| InChIKey | DSJGJVOIKSDFNP-RDYGGWIRSA-N |
| XLogP | 6.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|