C23H25N5O3 — CID 172744078
6-[4-[4-(cyanomethyl)phenyl]-3-oxo-1H-pyrazol-2-yl]-N-(5-methoxypentyl)pyridine-3-carboxamide (PubChem CID 172744078) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 6-[4-[4-(cyanomethyl)phenyl]-3-oxo-1H-pyrazol-2-yl]-N-(5-methoxypentyl)pyridine-3-carboxamide.
| Compound Name | 6-[4-[4-(cyanomethyl)phenyl]-3-oxo-1H-pyrazol-2-yl]-N-(5-methoxypentyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172744078 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 6-[4-[4-(cyanomethyl)phenyl]-3-oxo-1H-pyrazol-2-yl]-N-(5-methoxypentyl)pyridine-3-carboxamide |
| SMILES | COCCCCCNC(=O)c1ccc(-n2[nH]cc(-c3ccc(CC#N)cc3)c2=O)nc1 |
| InChI | InChI=1S/C23H25N5O3/c1-31-14-4-2-3-13-25-22(29)19-9-10-21(26-15-19)28-23(30)20(16-27-28)18-7-5-17(6-8-18)11-12-24/h5-10,15-16,27H,2-4,11,13-14H2,1H3,(H,25,29) |
| InChIKey | CBMXRXAPQLUMKV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|