C20H21N3O4 — CID 168846315
6-[4-(4-butoxy-3-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid (PubChem CID 168846315) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 6-[4-(4-butoxy-3-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[4-(4-butoxy-3-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 168846315 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 6-[4-(4-butoxy-3-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2c[nH]n(-c3ccc(C(=O)O)cn3)c2=O)cc1C |
| InChI | InChI=1S/C20H21N3O4/c1-3-4-9-27-17-7-5-14(10-13(17)2)16-12-22-23(19(16)24)18-8-6-15(11-21-18)20(25)26/h5-8,10-12,22H,3-4,9H2,1-2H3,(H,25,26) |
| InChIKey | OVMFJMXACRNGKD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|