C15H15F3N4 — CID 172744174
5-[4-tert-butyl-2-(trifluoromethyl)imidazol-1-yl]-1H-indazole (PubChem CID 172744174) has the molecular formula C15H15F3N4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 5-[4-tert-butyl-2-(trifluoromethyl)imidazol-1-yl]-1H-indazole.
| Compound Name | 5-[4-tert-butyl-2-(trifluoromethyl)imidazol-1-yl]-1H-indazole |
|---|---|
| PubChem CID | 172744174 |
| Molecular Formula | C15H15F3N4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 5-[4-tert-butyl-2-(trifluoromethyl)imidazol-1-yl]-1H-indazole |
| SMILES | CC(C)(C)c1cn(-c2ccc3[nH]ncc3c2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F3N4/c1-14(2,3)12-8-22(13(20-12)15(16,17)18)10-4-5-11-9(6-10)7-19-21-11/h4-8H,1-3H3,(H,19,21) |
| InChIKey | JMPHEKAXTWJEMG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |