C25H34N4O3 — CID 172745007
butyl 3-[4-(2-methylquinolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 172745007) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is butyl 3-[4-(2-methylquinolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | butyl 3-[4-(2-methylquinolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172745007 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | butyl 3-[4-(2-methylquinolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC(C(=O)N2CCN(c3cc(C)nc4ccccc34)CC2)C1 |
| InChI | InChI=1S/C25H34N4O3/c1-3-4-16-32-25(31)29-11-7-8-20(18-29)24(30)28-14-12-27(13-15-28)23-17-19(2)26-22-10-6-5-9-21(22)23/h5-6,9-10,17,20H,3-4,7-8,11-16,18H2,1-2H3 |
| InChIKey | JPHZNRCZEFTBLN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|