C24H33N5O3 — CID 166110435
tert-butyl 3-[4-(2-methylquinazolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 166110435) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl 3-[4-(2-methylquinazolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(2-methylquinazolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166110435 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | tert-butyl 3-[4-(2-methylquinazolin-4-yl)piperazine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | Cc1nc(N2CCN(C(=O)C3CCCN(C(=O)OC(C)(C)C)C3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C24H33N5O3/c1-17-25-20-10-6-5-9-19(20)21(26-17)27-12-14-28(15-13-27)22(30)18-8-7-11-29(16-18)23(31)32-24(2,3)4/h5-6,9-10,18H,7-8,11-16H2,1-4H3 |
| InChIKey | RYNVVDMYHVGBTJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |