C27H40O2 — CID 172745515
(2E,4E)-2-[4-(4-heptylcyclohexyl)phenyl]octa-2,4-dienoic acid (PubChem CID 172745515) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is (2E,4E)-2-[4-(4-heptylcyclohexyl)phenyl]octa-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-[4-(4-heptylcyclohexyl)phenyl]octa-2,4-dienoic acid |
|---|---|
| PubChem CID | 172745515 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (2E,4E)-2-[4-(4-heptylcyclohexyl)phenyl]octa-2,4-dienoic acid |
| SMILES | CCC/C=C/C=C(/C(=O)O)c1ccc(C2CCC(CCCCCCC)CC2)cc1 |
| InChI | InChI=1S/C27H40O2/c1-3-5-7-9-10-12-22-14-16-23(17-15-22)24-18-20-25(21-19-24)26(27(28)29)13-11-8-6-4-2/h8,11,13,18-23H,3-7,9-10,12,14-17H2,1-2H3,(H,28,29)/b11-8+,26-13+ |
| InChIKey | JQYYHFAUYSSWHP-PGYBVBNBSA-N |
| XLogP | 8.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|