C19H27N5O4 — CID 172745687
1-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-methoxyindole-2-carboxamide (PubChem CID 172745687) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-methoxyindole-2-carboxamide.
| Compound Name | 1-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-methoxyindole-2-carboxamide |
|---|---|
| PubChem CID | 172745687 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-methoxyindole-2-carboxamide |
| SMILES | COc1cccc2c1cc(C(N)=O)n2[C@@H](CC(C)C)C(=O)NNCCC(N)=O |
| InChI | InChI=1S/C19H27N5O4/c1-11(2)9-15(19(27)23-22-8-7-17(20)25)24-13-5-4-6-16(28-3)12(13)10-14(24)18(21)26/h4-6,10-11,15,22H,7-9H2,1-3H3,(H2,20,25)(H2,21,26)(H,23,27)/t15-/m0/s1 |
| InChIKey | JROXOQJVYJGASR-HNNXBMFYSA-N |
| XLogP | 0.83 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|