About 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide
4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide (PubChem CID 172746090) has the molecular formula C21H29ClN4O2
and a molecular weight of 404.94 g/mol. Its IUPAC name is 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide.
Molecular Properties
| Compound Name | 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide |
| PubChem CID | 172746090 |
| Molecular Formula | C21H29ClN4O2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(CNc2cnn(CCC)c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C21H29ClN4O2/c1-4-11-25(12-5-2)20(27)17-9-7-16(8-10-17)14-23-18-15-24-26(13-6-3)21(28)19(18)22/h7-10,15,23H,4-6,11-14H2,1-3H3 |
| InChIKey | JSXZKJVUCYTEHM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide?
The IUPAC name of 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide (CID 172746090) is 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide.
What is the SMILES notation for 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide?
The canonical SMILES for 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide is CCCN(CCC)C(=O)c1ccc(CNc2cnn(CCC)c(=O)c2Cl)cc1.
What is the InChIKey of 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide?
The InChIKey is JSXZKJVUCYTEHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29ClN4O2/c1-4-11-25(12-5-2)20(27)17-9-7-16(8-10-17)14-23-18-15-24-26(13-6-3)21(28)19(18)22/h7-10,15,23H,4-6,11-14H2,1-3H3.
What are the key properties of 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide?
4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide has a molecular weight of 404.94 g/mol, XLogP of 4.18, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5-chloro-6-oxo-1-propylpyridazin-4-yl)amino]methyl]-N,N-dipropylbenzamide is sourced from PubChem (CID 172746090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).