C10H19NO3Si — CID 172747799
2,2-diethoxyethyl(3-isocyanatoprop-1-enyl)silane (PubChem CID 172747799) has the molecular formula C10H19NO3Si and a molecular weight of 229.35 g/mol. Its IUPAC name is 2,2-diethoxyethyl(3-isocyanatoprop-1-enyl)silane.
| Compound Name | 2,2-diethoxyethyl(3-isocyanatoprop-1-enyl)silane |
|---|---|
| PubChem CID | 172747799 |
| Molecular Formula | C10H19NO3Si |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2,2-diethoxyethyl(3-isocyanatoprop-1-enyl)silane |
| SMILES | CCOC(C[SiH2]C=CCN=C=O)OCC |
| InChI | InChI=1S/C10H19NO3Si/c1-3-13-10(14-4-2)8-15-7-5-6-11-9-12/h5,7,10H,3-4,6,8,15H2,1-2H3 |
| InChIKey | JYPUPDUBCOIEKS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|