About N'-(2,2-diethoxyethyl)methanediimine
N'-(2,2-diethoxyethyl)methanediimine (PubChem CID 10749464) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is N'-(2,2-diethoxyethyl)methanediimine.
Molecular Properties
| Compound Name | N'-(2,2-diethoxyethyl)methanediimine |
| PubChem CID | 10749464 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N'-(2,2-diethoxyethyl)methanediimine |
| SMILES | CCOC(CN=C=N)OCC |
| InChI | InChI=1S/C7H14N2O2/c1-3-10-7(11-4-2)5-9-6-8/h7-8H,3-5H2,1-2H3 |
| InChIKey | BTEMNMAMFPCZKL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,2-diethoxyethyl)methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-diethoxyethyl)methanediimine?
The IUPAC name of N'-(2,2-diethoxyethyl)methanediimine (CID 10749464) is N'-(2,2-diethoxyethyl)methanediimine.
What is the SMILES notation for N'-(2,2-diethoxyethyl)methanediimine?
The canonical SMILES for N'-(2,2-diethoxyethyl)methanediimine is CCOC(CN=C=N)OCC.
What is the InChIKey of N'-(2,2-diethoxyethyl)methanediimine?
The InChIKey is BTEMNMAMFPCZKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-3-10-7(11-4-2)5-9-6-8/h7-8H,3-5H2,1-2H3.
What are the key properties of N'-(2,2-diethoxyethyl)methanediimine?
N'-(2,2-diethoxyethyl)methanediimine has a molecular weight of 158.20 g/mol, XLogP of 1.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-diethoxyethyl)methanediimine is sourced from PubChem (CID 10749464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).