About 2,2-diethoxyethyldiazene
2,2-diethoxyethyldiazene (PubChem CID 59807361) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2,2-diethoxyethyldiazene.
Molecular Properties
| Compound Name | 2,2-diethoxyethyldiazene |
| PubChem CID | 59807361 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2,2-diethoxyethyldiazene |
| SMILES | [H]/N=N/CC(OCC)OCC |
| InChI | InChI=1S/C6H14N2O2/c1-3-9-6(5-8-7)10-4-2/h6-7H,3-5H2,1-2H3/b8-7+ |
| InChIKey | TTWKZAFHVDBCHU-BQYQJAHWSA-N |
| XLogP | 1.42 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxyethyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxyethyldiazene?
The IUPAC name of 2,2-diethoxyethyldiazene (CID 59807361) is 2,2-diethoxyethyldiazene.
What is the SMILES notation for 2,2-diethoxyethyldiazene?
The canonical SMILES for 2,2-diethoxyethyldiazene is [H]/N=N/CC(OCC)OCC.
What is the InChIKey of 2,2-diethoxyethyldiazene?
The InChIKey is TTWKZAFHVDBCHU-BQYQJAHWSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-3-9-6(5-8-7)10-4-2/h6-7H,3-5H2,1-2H3/b8-7+.
What are the key properties of 2,2-diethoxyethyldiazene?
2,2-diethoxyethyldiazene has a molecular weight of 146.19 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxyethyldiazene is sourced from PubChem (CID 59807361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).