C8H19ClN2O2S — CID 173292091
methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydrochloride (PubChem CID 173292091) has the molecular formula C8H19ClN2O2S and a molecular weight of 242.77 g/mol. Its IUPAC name is methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydrochloride.
| Compound Name | methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 173292091 |
| Molecular Formula | C8H19ClN2O2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydrochloride |
| SMILES | CCOC(C/N=C(/N)SC)OCC.Cl |
| InChI | InChI=1S/C8H18N2O2S.ClH/c1-4-11-7(12-5-2)6-10-8(9)13-3;/h7H,4-6H2,1-3H3,(H2,9,10);1H |
| InChIKey | ILYVTCNITXHPPC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|