C8H18N2O2S — CID 15816903
methyl N'-(2,2-diethoxyethyl)carbamimidothioate (PubChem CID 15816903) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is methyl N'-(2,2-diethoxyethyl)carbamimidothioate.
| Compound Name | methyl N'-(2,2-diethoxyethyl)carbamimidothioate |
|---|---|
| PubChem CID | 15816903 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methyl N'-(2,2-diethoxyethyl)carbamimidothioate |
| SMILES | CCOC(C/N=C(/N)SC)OCC |
| InChI | InChI=1S/C8H18N2O2S/c1-4-11-7(12-5-2)6-10-8(9)13-3/h7H,4-6H2,1-3H3,(H2,9,10) |
| InChIKey | XKEQEORFWSBJHY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|