C8H17NO2S — CID 100936326
4,4-diethoxybutanethioamide (PubChem CID 100936326) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is 4,4-diethoxybutanethioamide.
| Compound Name | 4,4-diethoxybutanethioamide |
|---|---|
| PubChem CID | 100936326 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 4,4-diethoxybutanethioamide |
| SMILES | CCOC(CCC(N)=S)OCC |
| InChI | InChI=1S/C8H17NO2S/c1-3-10-8(11-4-2)6-5-7(9)12/h8H,3-6H2,1-2H3,(H2,9,12) |
| InChIKey | BMVBPIXWXGLKRX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|