About 2-ethoxypropane-1,3-diimine
2-ethoxypropane-1,3-diimine (PubChem CID 123387663) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 2-ethoxypropane-1,3-diimine.
Molecular Properties
| Compound Name | 2-ethoxypropane-1,3-diimine |
| PubChem CID | 123387663 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 2-ethoxypropane-1,3-diimine |
| SMILES | [H]/N=C/C(/C=N/[H])OCC |
| InChI | InChI=1S/C5H10N2O/c1-2-8-5(3-6)4-7/h3-7H,2H2,1H3/b6-3+,7-4+ |
| InChIKey | LJHYQEHOJGWDHH-XOKGJFMYSA-N |
| XLogP | 0.69 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxypropane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypropane-1,3-diimine?
The IUPAC name of 2-ethoxypropane-1,3-diimine (CID 123387663) is 2-ethoxypropane-1,3-diimine.
What is the SMILES notation for 2-ethoxypropane-1,3-diimine?
The canonical SMILES for 2-ethoxypropane-1,3-diimine is [H]/N=C/C(/C=N/[H])OCC.
What is the InChIKey of 2-ethoxypropane-1,3-diimine?
The InChIKey is LJHYQEHOJGWDHH-XOKGJFMYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-2-8-5(3-6)4-7/h3-7H,2H2,1H3/b6-3+,7-4+.
What are the key properties of 2-ethoxypropane-1,3-diimine?
2-ethoxypropane-1,3-diimine has a molecular weight of 114.15 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypropane-1,3-diimine is sourced from PubChem (CID 123387663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).