C7H14N2 — CID 150948733
N'-(2,3-dimethylbutyl)methanediimine (PubChem CID 150948733) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N'-(2,3-dimethylbutyl)methanediimine.
| Compound Name | N'-(2,3-dimethylbutyl)methanediimine |
|---|---|
| PubChem CID | 150948733 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N'-(2,3-dimethylbutyl)methanediimine |
| SMILES | CC(C)C(C)CN=C=N |
| InChI | InChI=1S/C7H14N2/c1-6(2)7(3)4-9-5-8/h6-8H,4H2,1-3H3 |
| InChIKey | LJQCWWUGDIKWHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|