C24H37NO3P+ — CID 172753258
[2,2-bis(2,6-diethylphenyl)-2-(dimethylamino)ethyl]-trihydroxyphosphanium (PubChem CID 172753258) has the molecular formula C24H37NO3P+ and a molecular weight of 418.54 g/mol. Its IUPAC name is [2,2-bis(2,6-diethylphenyl)-2-(dimethylamino)ethyl]-trihydroxyphosphanium.
| Compound Name | [2,2-bis(2,6-diethylphenyl)-2-(dimethylamino)ethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 172753258 |
| Molecular Formula | C24H37NO3P+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [2,2-bis(2,6-diethylphenyl)-2-(dimethylamino)ethyl]-trihydroxyphosphanium |
| SMILES | CCc1cccc(CC)c1C(C[P+](O)(O)O)(c1c(CC)cccc1CC)N(C)C |
| InChI | InChI=1S/C24H37NO3P/c1-7-18-13-11-14-19(8-2)22(18)24(25(5)6,17-29(26,27)28)23-20(9-3)15-12-16-21(23)10-4/h11-16,26-28H,7-10,17H2,1-6H3/q+1 |
| InChIKey | ZJULAOIMDDFRRQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|