C28H45NO3P+ — CID 172825669
[2-(dimethylamino)-2,2-bis[2,6-di(propan-2-yl)phenyl]ethyl]-trihydroxyphosphanium (PubChem CID 172825669) has the molecular formula C28H45NO3P+ and a molecular weight of 474.65 g/mol. Its IUPAC name is [2-(dimethylamino)-2,2-bis[2,6-di(propan-2-yl)phenyl]ethyl]-trihydroxyphosphanium.
| Compound Name | [2-(dimethylamino)-2,2-bis[2,6-di(propan-2-yl)phenyl]ethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 172825669 |
| Molecular Formula | C28H45NO3P+ |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | [2-(dimethylamino)-2,2-bis[2,6-di(propan-2-yl)phenyl]ethyl]-trihydroxyphosphanium |
| SMILES | CC(C)c1cccc(C(C)C)c1C(C[P+](O)(O)O)(c1c(C(C)C)cccc1C(C)C)N(C)C |
| InChI | InChI=1S/C28H45NO3P/c1-18(2)22-13-11-14-23(19(3)4)26(22)28(29(9)10,17-33(30,31)32)27-24(20(5)6)15-12-16-25(27)21(7)8/h11-16,18-21,30-32H,17H2,1-10H3/q+1 |
| InChIKey | DVNHNSLNDYPRCW-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|