C20H26N2O3 — CID 172753361
N-[(2,4-dimethoxyphenyl)methyl]-3-(4-methyloxan-2-yl)pyridin-2-amine (PubChem CID 172753361) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-(4-methyloxan-2-yl)pyridin-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-(4-methyloxan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 172753361 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-(4-methyloxan-2-yl)pyridin-2-amine |
| SMILES | COc1ccc(CNc2ncccc2C2CC(C)CCO2)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-14-8-10-25-19(11-14)17-5-4-9-21-20(17)22-13-15-6-7-16(23-2)12-18(15)24-3/h4-7,9,12,14,19H,8,10-11,13H2,1-3H3,(H,21,22) |
| InChIKey | KRLPGKRABGOMBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |