C21H27N7O2S — CID 172753368
tert-butyl 4-[N'-[[3-(dimethylamino)-2-pyridinyl]carbamothioyl]carbamimidoyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate (PubChem CID 172753368) has the molecular formula C21H27N7O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[3-(dimethylamino)-2-pyridinyl]carbamothioyl]carbamimidoyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate.
| Compound Name | tert-butyl 4-[N'-[[3-(dimethylamino)-2-pyridinyl]carbamothioyl]carbamimidoyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 172753368 |
| Molecular Formula | C21H27N7O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | tert-butyl 4-[N'-[[3-(dimethylamino)-2-pyridinyl]carbamothioyl]carbamimidoyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxylate |
| SMILES | CN(C)c1cccnc1NC(=S)N=C(N)c1nccc2c1CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C21H27N7O2S/c1-21(2,3)30-20(29)28-11-13-8-10-23-16(14(13)12-28)17(22)25-19(31)26-18-15(27(4)5)7-6-9-24-18/h6-10H,11-12H2,1-5H3,(H3,22,24,25,26,31) |
| InChIKey | KRLYWJNHFJSATD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|