1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid

C12H10N2O2 — CID 172754802

IUPAC1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid
SMILESO=C(O)C12C=CCN1c1ccccc1C=N2
InChIInChI=1S/C12H10N2O2/c15-11(16)12-6-3-7-14(12)10-5-2-1-4-9(10)8-13-12/h1-6,8H,7H2,(H,15,16)
InChIKeyKWIDGNLCZLKYHA-UHFFFAOYSA-N
MW214.22 g/mol
LogP1.28
Rot. Bonds1

About 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid

1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid (PubChem CID 172754802) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid.

Molecular Properties

Compound Name1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid
PubChem CID172754802
Molecular FormulaC12H10N2O2
Molecular Weight214.22 g/mol
Exact Mass214.07
IUPAC Name1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid
SMILESO=C(O)C12C=CCN1c1ccccc1C=N2
InChIInChI=1S/C12H10N2O2/c15-11(16)12-6-3-7-14(12)10-5-2-1-4-9(10)8-13-12/h1-6,8H,7H2,(H,15,16)
InChIKeyKWIDGNLCZLKYHA-UHFFFAOYSA-N
XLogP1.28
TPSA52.90 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.22
LogP ≤ 51.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid?
The IUPAC name of 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid (CID 172754802) is 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid.
What is the SMILES notation for 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid?
The canonical SMILES for 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid is O=C(O)C12C=CCN1c1ccccc1C=N2.
What is the InChIKey of 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid?
The InChIKey is KWIDGNLCZLKYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-11(16)12-6-3-7-14(12)10-5-2-1-4-9(10)8-13-12/h1-6,8H,7H2,(H,15,16).
What are the key properties of 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid?
1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid has a molecular weight of 214.22 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[1,2-a]quinazoline-3a-carboxylic acid is sourced from PubChem (CID 172754802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).