About 1-isocyanopentylbenzene
1-isocyanopentylbenzene (PubChem CID 172755000) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-isocyanopentylbenzene.
Molecular Properties
| Compound Name | 1-isocyanopentylbenzene |
| PubChem CID | 172755000 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-isocyanopentylbenzene |
| SMILES | [C-]#[N+]C(CCCC)c1ccccc1 |
| InChI | InChI=1S/C12H15N/c1-3-4-10-12(13-2)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1H3 |
| InChIKey | KWZQQDKJOKOUNN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanopentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanopentylbenzene?
The IUPAC name of 1-isocyanopentylbenzene (CID 172755000) is 1-isocyanopentylbenzene.
What is the SMILES notation for 1-isocyanopentylbenzene?
The canonical SMILES for 1-isocyanopentylbenzene is [C-]#[N+]C(CCCC)c1ccccc1.
What is the InChIKey of 1-isocyanopentylbenzene?
The InChIKey is KWZQQDKJOKOUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-3-4-10-12(13-2)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1H3.
What are the key properties of 1-isocyanopentylbenzene?
1-isocyanopentylbenzene has a molecular weight of 173.26 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanopentylbenzene is sourced from PubChem (CID 172755000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).