About hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane
hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane (PubChem CID 172755800) has the molecular formula C9H24O6
and a molecular weight of 228.28 g/mol. Its IUPAC name is hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane.
Molecular Properties
| Compound Name | hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane |
| PubChem CID | 172755800 |
| Molecular Formula | C9H24O6 |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane |
| SMILES | CC(C)(C)OO.CCC(C)(C)OO.OO |
| InChI | InChI=1S/C5H12O2.C4H10O2.H2O2/c1-4-5(2,3)7-6;1-4(2,3)6-5;1-2/h6H,4H2,1-3H3;5H,1-3H3;1-2H |
| InChIKey | KZTWEXPZODPEAQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane?
The IUPAC name of hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane (CID 172755800) is hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane.
What is the SMILES notation for hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane?
The canonical SMILES for hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane is CC(C)(C)OO.CCC(C)(C)OO.OO.
What is the InChIKey of hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane?
The InChIKey is KZTWEXPZODPEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H10O2.H2O2/c1-4-5(2,3)7-6;1-4(2,3)6-5;1-2/h6H,4H2,1-3H3;5H,1-3H3;1-2H.
What are the key properties of hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane?
hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane has a molecular weight of 228.28 g/mol, XLogP of 2.96, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;2-hydroperoxy-2-methylbutane;2-hydroperoxy-2-methylpropane is sourced from PubChem (CID 172755800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).