About 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate
2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate (PubChem CID 159910135) has the molecular formula C8H18O5
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate |
| PubChem CID | 159910135 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate |
| SMILES | CC(C)(C)OO.CCCOC(=O)O |
| InChI | InChI=1S/C4H8O3.C4H10O2/c1-2-3-7-4(5)6;1-4(2,3)6-5/h2-3H2,1H3,(H,5,6);5H,1-3H3 |
| InChIKey | NXBUMWQIPIEAIE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate?
The IUPAC name of 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate (CID 159910135) is 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate.
What is the SMILES notation for 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate?
The canonical SMILES for 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate is CC(C)(C)OO.CCCOC(=O)O.
What is the InChIKey of 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate?
The InChIKey is NXBUMWQIPIEAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C4H10O2/c1-2-3-7-4(5)6;1-4(2,3)6-5/h2-3H2,1H3,(H,5,6);5H,1-3H3.
What are the key properties of 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate?
2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate has a molecular weight of 194.23 g/mol, XLogP of 2.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroperoxy-2-methylpropane;propyl hydrogen carbonate is sourced from PubChem (CID 159910135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).