C26H31N3O4 — CID 172761323
2-[2-[(butoxycarbonylamino)methyl]phenyl]benzoic acid;2-pyridin-2-ylethanamine (PubChem CID 172761323) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-[2-[(butoxycarbonylamino)methyl]phenyl]benzoic acid;2-pyridin-2-ylethanamine.
| Compound Name | 2-[2-[(butoxycarbonylamino)methyl]phenyl]benzoic acid;2-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 172761323 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 2-[2-[(butoxycarbonylamino)methyl]phenyl]benzoic acid;2-pyridin-2-ylethanamine |
| SMILES | CCCCOC(=O)NCc1ccccc1-c1ccccc1C(=O)O.NCCc1ccccn1 |
| InChI | InChI=1S/C19H21NO4.C7H10N2/c1-2-3-12-24-19(23)20-13-14-8-4-5-9-15(14)16-10-6-7-11-17(16)18(21)22;8-5-4-7-3-1-2-6-9-7/h4-11H,2-3,12-13H2,1H3,(H,20,23)(H,21,22);1-3,6H,4-5,8H2 |
| InChIKey | LSJOVCDMHKAERV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|