C24H18F3O7S2+ — CID 172762731
methyl 2-[2-methoxy-5-(9-oxo-1H-thioxanthen-10-ium-1-ylium-10-yl)phenyl]acetate;trifluoromethanesulfonate (PubChem CID 172762731) has the molecular formula C24H18F3O7S2+ and a molecular weight of 539.53 g/mol. Its IUPAC name is methyl 2-[2-methoxy-5-(9-oxo-1H-thioxanthen-10-ium-1-ylium-10-yl)phenyl]acetate;trifluoromethanesulfonate.
| Compound Name | methyl 2-[2-methoxy-5-(9-oxo-1H-thioxanthen-10-ium-1-ylium-10-yl)phenyl]acetate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172762731 |
| Molecular Formula | C24H18F3O7S2+ |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | methyl 2-[2-methoxy-5-(9-oxo-1H-thioxanthen-10-ium-1-ylium-10-yl)phenyl]acetate;trifluoromethanesulfonate |
| SMILES | COC(=O)Cc1cc(-[s+]2c3c(c(=O)c4ccccc42)=[C+]C=CC=3)ccc1OC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H18O4S.CHF3O3S/c1-26-19-12-11-16(13-15(19)14-22(24)27-2)28-20-9-5-3-7-17(20)23(25)18-8-4-6-10-21(18)28;2-1(3,4)8(5,6)7/h3-7,9-13H,14H2,1-2H3;(H,5,6,7)/q+2;/p-1 |
| InChIKey | LXERXTXHJGISDQ-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|