C6H12N4O — CID 172762737
N-(1,3,5-triazinan-1-yl)prop-2-enamide (PubChem CID 172762737) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is N-(1,3,5-triazinan-1-yl)prop-2-enamide.
| Compound Name | N-(1,3,5-triazinan-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 172762737 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | N-(1,3,5-triazinan-1-yl)prop-2-enamide |
| SMILES | C=CC(=O)NN1CNCNC1 |
| InChI | InChI=1S/C6H12N4O/c1-2-6(11)9-10-4-7-3-8-5-10/h2,7-8H,1,3-5H2,(H,9,11) |
| InChIKey | LXFHJRJSGRUTST-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|