C12H18N6O3 — CID 23035947
N-[1,2-bis(prop-2-enoylamino)-1,3,5-triazinan-2-yl]prop-2-enamide (PubChem CID 23035947) has the molecular formula C12H18N6O3 and a molecular weight of 294.32 g/mol. Its IUPAC name is N-[1,2-bis(prop-2-enoylamino)-1,3,5-triazinan-2-yl]prop-2-enamide.
| Compound Name | N-[1,2-bis(prop-2-enoylamino)-1,3,5-triazinan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 23035947 |
| Molecular Formula | C12H18N6O3 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[1,2-bis(prop-2-enoylamino)-1,3,5-triazinan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NN1CNCNC1(NC(=O)C=C)NC(=O)C=C |
| InChI | InChI=1S/C12H18N6O3/c1-4-9(19)15-12(16-10(20)5-2)14-7-13-8-18(12)17-11(21)6-3/h4-6,13-14H,1-3,7-8H2,(H,15,19)(H,16,20)(H,17,21) |
| InChIKey | BKHSYVJZEHOMTR-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 114.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|