C25H26O4 — CID 172765833
(1-methylcyclopentyl) 3-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate (PubChem CID 172765833) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is (1-methylcyclopentyl) 3-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate.
| Compound Name | (1-methylcyclopentyl) 3-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate |
|---|---|
| PubChem CID | 172765833 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (1-methylcyclopentyl) 3-(11,12-dioxo-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate |
| SMILES | CC1(OC(=O)c2cccc(C3CC4C(=O)C3C3C5C=CC(C5=O)C43)c2)CCCC1 |
| InChI | InChI=1S/C25H26O4/c1-25(9-2-3-10-25)29-24(28)14-6-4-5-13(11-14)17-12-18-19-15-7-8-16(22(15)26)20(19)21(17)23(18)27/h4-8,11,15-21H,2-3,9-10,12H2,1H3 |
| InChIKey | MHLIFEONCXTINI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|