C44H82N2O6 — CID 172766791
[4-amino-2-[2-(ethylamino)ethoxy]-3-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl] (Z)-octadec-9-enoate (PubChem CID 172766791) has the molecular formula C44H82N2O6 and a molecular weight of 735.15 g/mol. Its IUPAC name is [4-amino-2-[2-(ethylamino)ethoxy]-3-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl] (Z)-octadec-9-enoate.
| Compound Name | [4-amino-2-[2-(ethylamino)ethoxy]-3-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 172766791 |
| Molecular Formula | C44H82N2O6 |
| Molecular Weight | 735.15 g/mol |
| Exact Mass | 734.62 |
| IUPAC Name | [4-amino-2-[2-(ethylamino)ethoxy]-3-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OCCNCC)C(OC(=O)CCCCCCC/C=C\CCCCCCCC)C(N)=O |
| InChI | InChI=1S/C44H82N2O6/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(47)51-39-40(50-38-37-46-6-3)43(44(45)49)52-42(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,40,43,46H,4-18,23-39H2,1-3H3,(H2,45,49)/b21-19-,22-20- |
| InChIKey | MKMZTCVYQMUBCF-WRBBJXAJSA-N |
| XLogP | 11.00 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.15 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|