C47H88N2O6 — CID 173310617
[4-amino-2-[2-[butyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutyl] octadec-9-enoate (PubChem CID 173310617) has the molecular formula C47H88N2O6 and a molecular weight of 777.23 g/mol. Its IUPAC name is [4-amino-2-[2-[butyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutyl] octadec-9-enoate.
| Compound Name | [4-amino-2-[2-[butyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutyl] octadec-9-enoate |
|---|---|
| PubChem CID | 173310617 |
| Molecular Formula | C47H88N2O6 |
| Molecular Weight | 777.23 g/mol |
| Exact Mass | 776.66 |
| IUPAC Name | [4-amino-2-[2-[butyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(OCCN(C)CCCC)C(OC(=O)CCCCCCCC=CCCCCCCCC)C(N)=O |
| InChI | InChI=1S/C47H88N2O6/c1-5-8-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44(50)54-42-43(53-41-40-49(4)39-10-7-3)46(47(48)52)55-45(51)38-36-34-32-30-28-26-24-22-20-18-16-14-12-9-6-2/h21-24,43,46H,5-20,25-42H2,1-4H3,(H2,48,52) |
| InChIKey | QIPRHAZFMWAQLS-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.23 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|