C45H84N2O6 — CID 173310794
[4-amino-1-[2-[ethyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutan-2-yl] octadec-9-enoate (PubChem CID 173310794) has the molecular formula C45H84N2O6 and a molecular weight of 749.18 g/mol. Its IUPAC name is [4-amino-1-[2-[ethyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutan-2-yl] octadec-9-enoate.
| Compound Name | [4-amino-1-[2-[ethyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutan-2-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 173310794 |
| Molecular Formula | C45H84N2O6 |
| Molecular Weight | 749.18 g/mol |
| Exact Mass | 748.63 |
| IUPAC Name | [4-amino-1-[2-[ethyl(methyl)amino]ethoxy]-3-octadec-9-enoyloxy-4-oxobutan-2-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(COCCN(C)CC)C(OC(=O)CCCCCCCC=CCCCCCCCC)C(N)=O |
| InChI | InChI=1S/C45H84N2O6/c1-5-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-42(48)52-41(40-51-39-38-47(4)7-3)44(45(46)50)53-43(49)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-6-2/h20-23,41,44H,5-19,24-40H2,1-4H3,(H2,46,50) |
| InChIKey | OYCGZTGEANESNT-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.18 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|